1. 05 Eylül 2013 Perşembe Reyting Tahminleri

    [​IMG]


    Bu perşembe reyting tahminlerinde ;

    ZORUNLU TAHMİNLER

    Zengin Kız Fakir Oğlan [B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B]TRT 1 - [/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B]19.50
    [/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]
    Örümcek Adam 3 STAR TV - 20.00
    [SIZE=3]Kurtlar Vadisi Pusu[/SIZE] (Kolaj Bölüm) ATV - [B][B][B][B][B]20.00[/B][/B][/B][/B][/B]
    [B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B]Sağ Salim (TV'de İlk )[/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B]KANAL D -[/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B]20.00 [/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]
    [B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B]Çocuklar Duymasın [/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B]FOX TV - [/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B]20.15




    [SIZE=5]BONUS TAHMİNLER[/SIZE]

    [/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]
    Trt 1
    [B][B][B][B][B][B][B][B][SIZE=2][B][B][B][B][B][B][B][B][SIZE=2][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=2][B][B][B][B][B][B][B][B][SIZE=2][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=2][B][B][B][B][B][B][B][B][SIZE=2][B][B][B][B][B][B][B][B][SIZE=2][B][B][B][B][B][SIZE=2][B][B][B][B][B][SIZE=2][B][B][B][B][B][B][B][B][SIZE=2][B][B][B][COLOR=#000000][SIZE=2]22.55 Tam Zamanı (Yarışma Programı - Yeni Bölüm)
    [/SIZE][/COLOR][/B][/B][/B][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/SIZE][/B][/B][/B][/B][/B][/SIZE][/B][/B][/B][/B][/B][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B]

    Star TV
    22.45 Benim Hâlâ Umudum Var (tkr)


    ATV

    23.30 Ada

    [B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][COLOR=Black][COLOR=Black][COLOR=Black][SIZE=2][B][B][COLOR=#ff0000][SIZE=3]Kanal D[/SIZE][/COLOR][COLOR=#000000][SIZE=2]
    22.15 Kapış Kapış[/SIZE][/COLOR][/B][/B][/SIZE][/COLOR][/COLOR][/COLOR][COLOR=Black][COLOR=Black][COLOR=Black][SIZE=2][B][B][COLOR=#000000][SIZE=2]
    [/SIZE][/COLOR][/B][/B][/SIZE][/COLOR][/COLOR][/COLOR][COLOR=Black][COLOR=Black][COLOR=Black][SIZE=2][B][B][COLOR=#000000][SIZE=2]
    [/SIZE][/COLOR][/B][/B][/SIZE][/COLOR][/COLOR][/COLOR][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]
    [B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][COLOR=Black][COLOR=Black][COLOR=Black][SIZE=2][COLOR=#ff0000][SIZE=3]Fox TV[/SIZE][/COLOR]
    [COLOR=#000000][SIZE=2]19.45 Deniz Yıldızı
    22.15 Fatih Harbiye (tkr)
    [/SIZE][/COLOR][/SIZE][/COLOR][/COLOR][/COLOR][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]

    [B][SIZE=2][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=2][B][B][B][B][B][B][B][B][SIZE=2][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=2][B][B][B][B][B][B][B][B][SIZE=2][B][B][B][B][B][SIZE=2][B][B][SIZE=2][B][B][COLOR=#ff0000][SIZE=3]Show TV[/SIZE][/COLOR][COLOR=#000000][SIZE=2]
    20.00 Bebek İşi (tkr)
    23.15 Kelime Oyunu (tkr)

    [/SIZE][/COLOR][/B][/B][/SIZE][/B][/B][/SIZE][/B][/B][/B][/B][/B][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/SIZE][/B]
    [B][B][B][SIZE=3][COLOR=#ff0000]Samanyolu TV[/COLOR][/SIZE]
    [SIZE=2][COLOR=#000000]18.55 İki Dünya Arasında [/COLOR][/SIZE]
    [SIZE=2][COLOR=#000000]20.45 Küçük Kıyamet [/COLOR][/SIZE]
    [SIZE=2][COLOR=#000000]22.30 Şefkat Tepe (tkr)
    [/COLOR][/SIZE][/B][/B][/B]
    [SIZE=2][B][B][B][B][B][B][B][B][SIZE=2][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=2][B][B][B][B][B][B][B][B][SIZE=2][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=2][B][B][B][B][B][B][B][B][SIZE=2][B][B][B][B][B][SIZE=2][B][B][SIZE=2][B][B][SIZE=2]

    Hangi yapım günü zirvede tamamlar?

    Sıralama ve reytingler nasıl olur?[/SIZE][/B][/B][/SIZE][/B][/B][/SIZE][/B][/B][/B][/B][/B][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/SIZE]










    Şunlar da ilginizi çekebilir:

    Last edited: 5 Eylül 2013


  2. Bully

    Bully Süper Mod.

    Total-Ab Zorunlu

    Zengin Kız Fakir Oğlan 4.5 - 5
    Örümcek Adam 3 3.5 - 2.8
    Kurtlar Vadisi Pusu 2.6 - 2.3
    Sağ Salim 4.7 - 4
    Çocuklar Duymasın 2.9 - 2.3

    Total-Ab Bonus

    Kapış Kapış 2.5 - 2.1
    Deniz Yıldızı 2.2 - 1.5
    Kelime Oyunu (tkr) 1- 1.3
    Fatih Harbiye (tkr) 2.4 - 2.2

    Last edited: 6 Eylül 2013
  3. denizz19

    denizz19 Favori Üye

    Total Zengin Kız Fakir Oğlan 460
    Örümcek Adam 395
    Kurtlar Vadisi Pusu 245
    Sağ Salim 595
    Çocuklar Duymasın 275


    Ab Zengin Kız Fakir Oğlan 5
    Örümcek Adam 3
    Kurtlar Vadisi Pusu 215
    Sağ Salim 450
    Çocuklar Duymasın 220


    Total Bonus Deniz Yıldızı 215
    Bebek İşi 220
    İki Dünya Arasında 230
    Şefkat Tepe 175

    Ab Bonus Deniz Yıldızı 145
    Bebek İşi 225
    İki Dünya Arasında 075
    Şefkat Tepe 065

    Last edited: 6 Eylül 2013
  4. Yasin93

    Yasin93 Favori Üye

    TOTAL:

    1. Zengin Kiz Fakir Oglan 4.10 Reyting
    2. Kurtlar Vadisi Pusu (Kolaj) 3.65 Reyting
    3. Sag Salim 3.40 Reyting
    4. Örümcek Adam 3 3.05 Reyting
    5. Cocuklar Duymasin 2.90 Reyting

    AB:

    1. Sag Salim 4.60 Reyting
    2. Zengin Kiz Fakir Oglan 4.05 Reyting
    3. Kurtlar Vadisi Pusu (Kolaj) 3.20 Reyting
    4. Örümcek Adam 3 3.00 Reyting
    5. Cocuklar Duymasin 2.50 Reyting

  5. ibp

    ibp


    3

    1
    TOTAL
    1.Sağ Salim 4.90 Reyting
    2. Zengin Kız Fakir Oğlan 4.56 Reyting
    3. Kurtlar Vadisi Pusu Kolah 4.50 Reyting
    4. Örümcek Adam 3 4.10 Reyting
    5. Çocuklar Duymasın 3.40 Reyting

    AB
    1. Zengin kız fakir oğlan 5.5 reyting
    2. Kurtlar Vadisi Pusu Kolaş 5.3 reyting
    3. Sağl salim 4.4 reyting
    4. örümcek adam 3 4.1 reyting
    5.cocuklar duymasın 3.7 reyting

  6. [​IMG]

    Reyting Tahminim:
    04 Eylül 2013
    Çarşamba

    Zengin Kız Fakir Oğlan
    TOTAL: 4
    A/B: 4.5

    Örümcek Adam 3
    TOTAL: 3
    A/B: 2.5

    Kurtlar Vadisi Pusu (Kolaj Bölüm)
    TOTAL: 3.5
    A/B: 3



    Sağ Salim (TV'de İlk Kez)
    TOTAL: 3.7
    A/B: 4


    Çocuklar Duymasın
    TOTAL: 2.7
    A/B: 3


  7. TOTAL:

    1. Zengin Kiz Fakir Oglan 4
    2. Kurtlar Vadisi Pusu (Kolaj) 3
    3. Sag Salim 3.5
    4. Örümcek Adam 3 3.25
    5. Cocuklar Duymasin 3

    AB:

    1. Sag Salim 4
    2. Zengin Kiz Fakir Oglan 4
    3. Kurtlar Vadisi Pusu 2
    4. Örümcek Adam 3 2.9
    5. Cocuklar Duymasin 2.5

  8. Reytinger

    Reytinger Favori Üye

    Total:
    Zengin Kız Fakir Oğlan: 433
    Örümcek Adam 3: 321
    Sağ Salim: 514
    Kurtlar Vadisi Pusu(Kolaj): 251
    Çocuklar Duymasın: 279

    A/B:
    Zengin Kız Fakir Oğlan: 511
    Örümcek Adam 3: 255
    Sağ Salim: 498
    Kurtlar Vadisi Pusu(Kolaj): 211
    Çocuklar Duymasın: 234

  9. Total
    Zengin Kız Fakir Oğlan 4.55
    Spider-Man 3 3.70
    Kurtlar Vadisi Pusu 3.25
    Sağ Salim 5.25
    Çocuklar Duymasın 2.80
    Deniz Yıldızı 2.18
    Bebek İşi 2
    İki Dünya Arasında 2.15
    Kelime Oyunu 0.90
    Ab
    Zengin Kız Fakir Oğlan 5
    Spider-Man 3 2.90
    Kurtlar Vadisi Pusu 2.35
    Sağ Salim 4.25
    Çocuklar Duymasın 2.25
    Deniz Yıldızı 1.80
    Bebek İşi 2.05
    İki Dünya Arasında 0.85
    Kelime Oyunu 1.15

  10. TOTAL - AB


    Zengin Kız Fakir Oğlan 5.4 - 5.6
    Örümcek Adam 3 4 - 4
    [B][COLOR=#800000][SIZE=3]Kurtlar Vadisi Pusu[/SIZE][/COLOR] 2.5 - 2.1
    [/B]
    [B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B]Sağ Salim (TV'de İlk ) 5.9 - 5.7
    [/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]
    [B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B]Çocuklar Duymasın 3 - 3.1[/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]


  11. legolas9900

    legolas9900 Favori Üye

    Total - ab
    Zengin Kız Fakir Oğlan TRT 1 - 19.50. 4.7 - 5.1
    Örümcek Adam 3 STAR TV - 20.00 3.3 - 3.1
    Kurtlar Vadisi Pusu (Kolaj Bölüm) ATV - 20.00 3 - 2.5
    Sağ Salim (TV'de İlk )KANAL D -20.00 4.8 - 4.5
    Çocuklar Duymasın FOX TV - 20.15 3 - 3

    Insallah halen gecerlidir


Bu konu 'Reyting & TV Anketleri' forumundadır ve hayret bi şey tarafından 5 Eylül 2013 başlatılmıştır.

Sayfayı Paylaş